C25H22FN5O5 — CID 146635943
3-[7-[[1-(4-cyclopropyloxy-2-fluorophenyl)triazol-4-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 146635943) has the molecular formula C25H22FN5O5 and a molecular weight of 491.48 g/mol. Its IUPAC name is 3-[7-[[1-(4-cyclopropyloxy-2-fluorophenyl)triazol-4-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[[1-(4-cyclopropyloxy-2-fluorophenyl)triazol-4-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146635943 |
| Molecular Formula | C25H22FN5O5 |
| Molecular Weight | 491.48 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | 3-[7-[[1-(4-cyclopropyloxy-2-fluorophenyl)triazol-4-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(OCc4cn(-c5ccc(OC6CC6)cc5F)nn4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C25H22FN5O5/c26-19-10-16(36-15-4-5-15)6-7-20(19)31-11-14(28-29-31)13-35-22-3-1-2-17-18(22)12-30(25(17)34)21-8-9-23(32)27-24(21)33/h1-3,6-7,10-11,15,21H,4-5,8-9,12-13H2,(H,27,32,33) |
| InChIKey | JDKUTSQYGQDUCN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.48 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|