C30H33F3N6O2S — CID 146636178
(1R,3S,5R)-3-[[4-(5-methoxy-3-pyridinyl)phenyl]methylamino]-N,N-dimethyl-5-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexane-1-carboxamide (PubChem CID 146636178) has the molecular formula C30H33F3N6O2S and a molecular weight of 598.70 g/mol. Its IUPAC name is (1R,3S,5R)-3-[[4-(5-methoxy-3-pyridinyl)phenyl]methylamino]-N,N-dimethyl-5-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexane-1-carboxamide.
| Compound Name | (1R,3S,5R)-3-[[4-(5-methoxy-3-pyridinyl)phenyl]methylamino]-N,N-dimethyl-5-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 146636178 |
| Molecular Formula | C30H33F3N6O2S |
| Molecular Weight | 598.70 g/mol |
| Exact Mass | 598.23 |
| IUPAC Name | (1R,3S,5R)-3-[[4-(5-methoxy-3-pyridinyl)phenyl]methylamino]-N,N-dimethyl-5-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexane-1-carboxamide |
| SMILES | COc1cncc(-c2ccc(CN[C@@H]3C[C@H](Nc4ncnc5sc(CC(F)(F)F)cc45)C[C@H](C(=O)N(C)C)C3)cc2)c1 |
| InChI | InChI=1S/C30H33F3N6O2S/c1-39(2)29(40)20-8-22(35-14-18-4-6-19(7-5-18)21-10-24(41-3)16-34-15-21)11-23(9-20)38-27-26-12-25(13-30(31,32)33)42-28(26)37-17-36-27/h4-7,10,12,15-17,20,22-23,35H,8-9,11,13-14H2,1-3H3,(H,36,37,38)/t20-,22+,23-/m1/s1 |
| InChIKey | QMURCSDQOKCCOZ-AKIFATBCSA-N |
| XLogP | 5.69 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.70 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |