C18H18F3N5O3S — CID 146636267
[(1S,3S,5R)-3-(1,3-oxazol-2-yl)-5-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]carbamic acid (PubChem CID 146636267) has the molecular formula C18H18F3N5O3S and a molecular weight of 441.44 g/mol. Its IUPAC name is [(1S,3S,5R)-3-(1,3-oxazol-2-yl)-5-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]carbamic acid.
| Compound Name | [(1S,3S,5R)-3-(1,3-oxazol-2-yl)-5-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 146636267 |
| Molecular Formula | C18H18F3N5O3S |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | [(1S,3S,5R)-3-(1,3-oxazol-2-yl)-5-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]carbamic acid |
| SMILES | O=C(O)N[C@@H]1C[C@H](Nc2ncnc3sc(CC(F)(F)F)cc23)C[C@H](c2ncco2)C1 |
| InChI | InChI=1S/C18H18F3N5O3S/c19-18(20,21)7-12-6-13-14(23-8-24-16(13)30-12)25-10-3-9(15-22-1-2-29-15)4-11(5-10)26-17(27)28/h1-2,6,8-11,26H,3-5,7H2,(H,27,28)(H,23,24,25)/t9-,10+,11-/m0/s1 |
| InChIKey | NFJFRMCUOJRGKE-AXFHLTTASA-N |
| XLogP | 4.17 |
| TPSA | 113.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |