C28H33F3N4O4S — CID 146636300
methyl 4-[[(2-methylpropan-2-yl)oxycarbonyl-[(1S,3R)-3-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]amino]methyl]benzoate (PubChem CID 146636300) has the molecular formula C28H33F3N4O4S and a molecular weight of 578.66 g/mol. Its IUPAC name is methyl 4-[[(2-methylpropan-2-yl)oxycarbonyl-[(1S,3R)-3-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[(2-methylpropan-2-yl)oxycarbonyl-[(1S,3R)-3-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 146636300 |
| Molecular Formula | C28H33F3N4O4S |
| Molecular Weight | 578.66 g/mol |
| Exact Mass | 578.22 |
| IUPAC Name | methyl 4-[[(2-methylpropan-2-yl)oxycarbonyl-[(1S,3R)-3-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(C(=O)OC(C)(C)C)[C@H]2CCC[C@@H](Nc3ncnc4sc(CC(F)(F)F)cc34)C2)cc1 |
| InChI | InChI=1S/C28H33F3N4O4S/c1-27(2,3)39-26(37)35(15-17-8-10-18(11-9-17)25(36)38-4)20-7-5-6-19(12-20)34-23-22-13-21(14-28(29,30)31)40-24(22)33-16-32-23/h8-11,13,16,19-20H,5-7,12,14-15H2,1-4H3,(H,32,33,34)/t19-,20+/m1/s1 |
| InChIKey | ICRSAUGBROJEMW-UXHICEINSA-N |
| XLogP | 6.74 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.66 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |