C15H25BrO5 — CID 146636468
pent-4-enyl 2-[(2-bromo-2-methylpropanoyl)oxymethyl]-3-methoxy-2-methylpropanoate (PubChem CID 146636468) has the molecular formula C15H25BrO5 and a molecular weight of 365.26 g/mol. Its IUPAC name is pent-4-enyl 2-[(2-bromo-2-methylpropanoyl)oxymethyl]-3-methoxy-2-methylpropanoate.
| Compound Name | pent-4-enyl 2-[(2-bromo-2-methylpropanoyl)oxymethyl]-3-methoxy-2-methylpropanoate |
|---|---|
| PubChem CID | 146636468 |
| Molecular Formula | C15H25BrO5 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | pent-4-enyl 2-[(2-bromo-2-methylpropanoyl)oxymethyl]-3-methoxy-2-methylpropanoate |
| SMILES | C=CCCCOC(=O)C(C)(COC)COC(=O)C(C)(C)Br |
| InChI | InChI=1S/C15H25BrO5/c1-6-7-8-9-20-13(18)15(4,10-19-5)11-21-12(17)14(2,3)16/h6H,1,7-11H2,2-5H3 |
| InChIKey | VKZOFTYTXDSPDI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|