About 4-(4-bromophenyl)-2,6-diphenylpyridine
4-(4-bromophenyl)-2,6-diphenylpyridine (PubChem CID 146636507) has the molecular formula C46H32Br2N2
and a molecular weight of 772.58 g/mol. Its IUPAC name is 4-(4-bromophenyl)-2,6-diphenylpyridine.
Molecular Properties
| Compound Name | 4-(4-bromophenyl)-2,6-diphenylpyridine |
| PubChem CID | 146636507 |
| Molecular Formula | C46H32Br2N2 |
| Molecular Weight | 772.58 g/mol |
| Exact Mass | 770.09 |
| IUPAC Name | 4-(4-bromophenyl)-2,6-diphenylpyridine |
| SMILES | Brc1ccc(-c2cc(-c3ccccc3)nc(-c3ccccc3)c2)cc1.Brc1ccc(-c2cc(-c3ccccc3)nc(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/2C23H16BrN/c2*24-21-13-11-17(12-14-21)20-15-22(18-7-3-1-4-8-18)25-23(16-20)19-9-5-2-6-10-19/h2*1-16H |
| InChIKey | ZBDMZFRXHBADOL-UHFFFAOYSA-N |
| XLogP | 13.69 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 772.58 |
| LogP ≤ 5 | 13.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4-bromophenyl)-2,6-diphenylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-bromophenyl)-2,6-diphenylpyridine?
The IUPAC name of 4-(4-bromophenyl)-2,6-diphenylpyridine (CID 146636507) is 4-(4-bromophenyl)-2,6-diphenylpyridine.
What is the SMILES notation for 4-(4-bromophenyl)-2,6-diphenylpyridine?
The canonical SMILES for 4-(4-bromophenyl)-2,6-diphenylpyridine is Brc1ccc(-c2cc(-c3ccccc3)nc(-c3ccccc3)c2)cc1.Brc1ccc(-c2cc(-c3ccccc3)nc(-c3ccccc3)c2)cc1.
What is the InChIKey of 4-(4-bromophenyl)-2,6-diphenylpyridine?
The InChIKey is ZBDMZFRXHBADOL-UHFFFAOYSA-N. The full InChI is InChI=1S/2C23H16BrN/c2*24-21-13-11-17(12-14-21)20-15-22(18-7-3-1-4-8-18)25-23(16-20)19-9-5-2-6-10-19/h2*1-16H.
What are the key properties of 4-(4-bromophenyl)-2,6-diphenylpyridine?
4-(4-bromophenyl)-2,6-diphenylpyridine has a molecular weight of 772.58 g/mol, XLogP of 13.69, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-bromophenyl)-2,6-diphenylpyridine is sourced from PubChem (CID 146636507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).