About ethyl 5-amino-1-(4,4-difluorocyclohexyl)pyrazole-4-carboxylate
ethyl 5-amino-1-(4,4-difluorocyclohexyl)pyrazole-4-carboxylate (PubChem CID 146636531) has the molecular formula C12H17F2N3O2
and a molecular weight of 273.28 g/mol. Its IUPAC name is ethyl 5-amino-1-(4,4-difluorocyclohexyl)pyrazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-amino-1-(4,4-difluorocyclohexyl)pyrazole-4-carboxylate |
| PubChem CID | 146636531 |
| Molecular Formula | C12H17F2N3O2 |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | ethyl 5-amino-1-(4,4-difluorocyclohexyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(C2CCC(F)(F)CC2)c1N |
| InChI | InChI=1S/C12H17F2N3O2/c1-2-19-11(18)9-7-16-17(10(9)15)8-3-5-12(13,14)6-4-8/h7-8H,2-6,15H2,1H3 |
| InChIKey | JVYOBXNIAXQJSV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 5-amino-1-(4,4-difluorocyclohexyl)pyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-amino-1-(4,4-difluorocyclohexyl)pyrazole-4-carboxylate?
The IUPAC name of ethyl 5-amino-1-(4,4-difluorocyclohexyl)pyrazole-4-carboxylate (CID 146636531) is ethyl 5-amino-1-(4,4-difluorocyclohexyl)pyrazole-4-carboxylate.
What is the SMILES notation for ethyl 5-amino-1-(4,4-difluorocyclohexyl)pyrazole-4-carboxylate?
The canonical SMILES for ethyl 5-amino-1-(4,4-difluorocyclohexyl)pyrazole-4-carboxylate is CCOC(=O)c1cnn(C2CCC(F)(F)CC2)c1N.
What is the InChIKey of ethyl 5-amino-1-(4,4-difluorocyclohexyl)pyrazole-4-carboxylate?
The InChIKey is JVYOBXNIAXQJSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F2N3O2/c1-2-19-11(18)9-7-16-17(10(9)15)8-3-5-12(13,14)6-4-8/h7-8H,2-6,15H2,1H3.
What are the key properties of ethyl 5-amino-1-(4,4-difluorocyclohexyl)pyrazole-4-carboxylate?
ethyl 5-amino-1-(4,4-difluorocyclohexyl)pyrazole-4-carboxylate has a molecular weight of 273.28 g/mol, XLogP of 2.39, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-amino-1-(4,4-difluorocyclohexyl)pyrazole-4-carboxylate is sourced from PubChem (CID 146636531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).