C15H23NO7S — CID 146636866
2-amino-3-[[(3Z,5Z)-10,11-dihydroxy-3,6-dimethyl-2,9-dioxabicyclo[5.2.2]undeca-3,5-dien-8-yl]methylsulfinyl]propanoic acid (PubChem CID 146636866) has the molecular formula C15H23NO7S and a molecular weight of 361.42 g/mol. Its IUPAC name is 2-amino-3-[[(3Z,5Z)-10,11-dihydroxy-3,6-dimethyl-2,9-dioxabicyclo[5.2.2]undeca-3,5-dien-8-yl]methylsulfinyl]propanoic acid.
| Compound Name | 2-amino-3-[[(3Z,5Z)-10,11-dihydroxy-3,6-dimethyl-2,9-dioxabicyclo[5.2.2]undeca-3,5-dien-8-yl]methylsulfinyl]propanoic acid |
|---|---|
| PubChem CID | 146636866 |
| Molecular Formula | C15H23NO7S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 2-amino-3-[[(3Z,5Z)-10,11-dihydroxy-3,6-dimethyl-2,9-dioxabicyclo[5.2.2]undeca-3,5-dien-8-yl]methylsulfinyl]propanoic acid |
| SMILES | C/C1=C/C=C(/C)C2C(CS(=O)CC(N)C(=O)O)OC(O1)C(O)C2O |
| InChI | InChI=1S/C15H23NO7S/c1-7-3-4-8(2)22-15-13(18)12(17)11(7)10(23-15)6-24(21)5-9(16)14(19)20/h3-4,9-13,15,17-18H,5-6,16H2,1-2H3,(H,19,20)/b7-3-,8-4- |
| InChIKey | QCBUUSLXDANWLN-VHOZIDCHSA-N |
| XLogP | -0.91 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |