C13H17NO — CID 146636959
(4E,6E)-4-(C-methyl-N-prop-1-en-2-ylcarbonimidoyl)octa-1,4,6-trien-3-one (PubChem CID 146636959) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is (4E,6E)-4-(C-methyl-N-prop-1-en-2-ylcarbonimidoyl)octa-1,4,6-trien-3-one.
| Compound Name | (4E,6E)-4-(C-methyl-N-prop-1-en-2-ylcarbonimidoyl)octa-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 146636959 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | (4E,6E)-4-(C-methyl-N-prop-1-en-2-ylcarbonimidoyl)octa-1,4,6-trien-3-one |
| SMILES | C=CC(=O)C(=C/C=C/C)/C(C)=N/C(=C)C |
| InChI | InChI=1S/C13H17NO/c1-6-8-9-12(13(15)7-2)11(5)14-10(3)4/h6-9H,2-3H2,1,4-5H3/b8-6+,12-9+,14-11+ |
| InChIKey | GYWUSICSNGPLIU-SANJMHPDSA-N |
| XLogP | 3.24 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|