C30H36N4O2 — CID 146637167
2-[2-[(2,4,9-triphenyl-1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)methoxy]ethoxy]ethanamine (PubChem CID 146637167) has the molecular formula C30H36N4O2 and a molecular weight of 484.64 g/mol. Its IUPAC name is 2-[2-[(2,4,9-triphenyl-1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)methoxy]ethoxy]ethanamine.
| Compound Name | 2-[2-[(2,4,9-triphenyl-1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)methoxy]ethoxy]ethanamine |
|---|---|
| PubChem CID | 146637167 |
| Molecular Formula | C30H36N4O2 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | 2-[2-[(2,4,9-triphenyl-1,3,5-triazatricyclo[3.3.1.13,7]decan-7-yl)methoxy]ethoxy]ethanamine |
| SMILES | NCCOCCOCC12CN3C(c4ccccc4)N(C1)C(c1ccccc1)N(C2)C3c1ccccc1 |
| InChI | InChI=1S/C30H36N4O2/c31-16-17-35-18-19-36-23-30-20-32-27(24-10-4-1-5-11-24)33(21-30)29(26-14-8-3-9-15-26)34(22-30)28(32)25-12-6-2-7-13-25/h1-15,27-29H,16-23,31H2 |
| InChIKey | DCCWSFNBBCBPGJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 54.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|