About (5R)-N-methyl-2,7-diazaspiro[4.4]nonane-2-carboxamide
(5R)-N-methyl-2,7-diazaspiro[4.4]nonane-2-carboxamide (PubChem CID 146637195) has the molecular formula C9H17N3O
and a molecular weight of 183.25 g/mol. Its IUPAC name is (5R)-N-methyl-2,7-diazaspiro[4.4]nonane-2-carboxamide.
Molecular Properties
| Compound Name | (5R)-N-methyl-2,7-diazaspiro[4.4]nonane-2-carboxamide |
| PubChem CID | 146637195 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | (5R)-N-methyl-2,7-diazaspiro[4.4]nonane-2-carboxamide |
| SMILES | CNC(=O)N1CC[C@@]2(CCNC2)C1 |
| InChI | InChI=1S/C9H17N3O/c1-10-8(13)12-5-3-9(7-12)2-4-11-6-9/h11H,2-7H2,1H3,(H,10,13)/t9-/m1/s1 |
| InChIKey | KDNNCZZMVGOTMC-SECBINFHSA-N |
| XLogP | 0.01 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5R)-N-methyl-2,7-diazaspiro[4.4]nonane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-N-methyl-2,7-diazaspiro[4.4]nonane-2-carboxamide?
The IUPAC name of (5R)-N-methyl-2,7-diazaspiro[4.4]nonane-2-carboxamide (CID 146637195) is (5R)-N-methyl-2,7-diazaspiro[4.4]nonane-2-carboxamide.
What is the SMILES notation for (5R)-N-methyl-2,7-diazaspiro[4.4]nonane-2-carboxamide?
The canonical SMILES for (5R)-N-methyl-2,7-diazaspiro[4.4]nonane-2-carboxamide is CNC(=O)N1CC[C@@]2(CCNC2)C1.
What is the InChIKey of (5R)-N-methyl-2,7-diazaspiro[4.4]nonane-2-carboxamide?
The InChIKey is KDNNCZZMVGOTMC-SECBINFHSA-N. The full InChI is InChI=1S/C9H17N3O/c1-10-8(13)12-5-3-9(7-12)2-4-11-6-9/h11H,2-7H2,1H3,(H,10,13)/t9-/m1/s1.
What are the key properties of (5R)-N-methyl-2,7-diazaspiro[4.4]nonane-2-carboxamide?
(5R)-N-methyl-2,7-diazaspiro[4.4]nonane-2-carboxamide has a molecular weight of 183.25 g/mol, XLogP of 0.01, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-N-methyl-2,7-diazaspiro[4.4]nonane-2-carboxamide is sourced from PubChem (CID 146637195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).