C9H7FN4 — CID 146637293
3-(3-fluoro-4-methylphenyl)-1,2,4,5-tetrazine (PubChem CID 146637293) has the molecular formula C9H7FN4 and a molecular weight of 190.18 g/mol. Its IUPAC name is 3-(3-fluoro-4-methylphenyl)-1,2,4,5-tetrazine.
| Compound Name | 3-(3-fluoro-4-methylphenyl)-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 146637293 |
| Molecular Formula | C9H7FN4 |
| Molecular Weight | 190.18 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 3-(3-fluoro-4-methylphenyl)-1,2,4,5-tetrazine |
| SMILES | Cc1ccc(-c2nncnn2)cc1F |
| InChI | InChI=1S/C9H7FN4/c1-6-2-3-7(4-8(6)10)9-13-11-5-12-14-9/h2-5H,1H3 |
| InChIKey | FKAQGPGZNDPFMP-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.18 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |