About methyl 2-fluoro-4-(1,2,4,5-tetrazin-3-yl)benzoate
methyl 2-fluoro-4-(1,2,4,5-tetrazin-3-yl)benzoate (PubChem CID 146637326) has the molecular formula C10H7FN4O2
and a molecular weight of 234.19 g/mol. Its IUPAC name is methyl 2-fluoro-4-(1,2,4,5-tetrazin-3-yl)benzoate.
Molecular Properties
| Compound Name | methyl 2-fluoro-4-(1,2,4,5-tetrazin-3-yl)benzoate |
| PubChem CID | 146637326 |
| Molecular Formula | C10H7FN4O2 |
| Molecular Weight | 234.19 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | methyl 2-fluoro-4-(1,2,4,5-tetrazin-3-yl)benzoate |
| SMILES | COC(=O)c1ccc(-c2nncnn2)cc1F |
| InChI | InChI=1S/C10H7FN4O2/c1-17-10(16)7-3-2-6(4-8(7)11)9-14-12-5-13-15-9/h2-5H,1H3 |
| InChIKey | AELIWXJUPMFWQP-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 77.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.19 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-fluoro-4-(1,2,4,5-tetrazin-3-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-fluoro-4-(1,2,4,5-tetrazin-3-yl)benzoate?
The IUPAC name of methyl 2-fluoro-4-(1,2,4,5-tetrazin-3-yl)benzoate (CID 146637326) is methyl 2-fluoro-4-(1,2,4,5-tetrazin-3-yl)benzoate.
What is the SMILES notation for methyl 2-fluoro-4-(1,2,4,5-tetrazin-3-yl)benzoate?
The canonical SMILES for methyl 2-fluoro-4-(1,2,4,5-tetrazin-3-yl)benzoate is COC(=O)c1ccc(-c2nncnn2)cc1F.
What is the InChIKey of methyl 2-fluoro-4-(1,2,4,5-tetrazin-3-yl)benzoate?
The InChIKey is AELIWXJUPMFWQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7FN4O2/c1-17-10(16)7-3-2-6(4-8(7)11)9-14-12-5-13-15-9/h2-5H,1H3.
What are the key properties of methyl 2-fluoro-4-(1,2,4,5-tetrazin-3-yl)benzoate?
methyl 2-fluoro-4-(1,2,4,5-tetrazin-3-yl)benzoate has a molecular weight of 234.19 g/mol, XLogP of 0.86, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-fluoro-4-(1,2,4,5-tetrazin-3-yl)benzoate is sourced from PubChem (CID 146637326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).