About 3-fluoro-5-(1,2,4,5-tetrazin-3-yl)phenol
3-fluoro-5-(1,2,4,5-tetrazin-3-yl)phenol (PubChem CID 146637330) has the molecular formula C8H5FN4O
and a molecular weight of 192.15 g/mol. Its IUPAC name is 3-fluoro-5-(1,2,4,5-tetrazin-3-yl)phenol.
Molecular Properties
| Compound Name | 3-fluoro-5-(1,2,4,5-tetrazin-3-yl)phenol |
| PubChem CID | 146637330 |
| Molecular Formula | C8H5FN4O |
| Molecular Weight | 192.15 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 3-fluoro-5-(1,2,4,5-tetrazin-3-yl)phenol |
| SMILES | Oc1cc(F)cc(-c2nncnn2)c1 |
| InChI | InChI=1S/C8H5FN4O/c9-6-1-5(2-7(14)3-6)8-12-10-4-11-13-8/h1-4,14H |
| InChIKey | ZVCOSETYYFBCQF-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 71.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.15 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-fluoro-5-(1,2,4,5-tetrazin-3-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-5-(1,2,4,5-tetrazin-3-yl)phenol?
The IUPAC name of 3-fluoro-5-(1,2,4,5-tetrazin-3-yl)phenol (CID 146637330) is 3-fluoro-5-(1,2,4,5-tetrazin-3-yl)phenol.
What is the SMILES notation for 3-fluoro-5-(1,2,4,5-tetrazin-3-yl)phenol?
The canonical SMILES for 3-fluoro-5-(1,2,4,5-tetrazin-3-yl)phenol is Oc1cc(F)cc(-c2nncnn2)c1.
What is the InChIKey of 3-fluoro-5-(1,2,4,5-tetrazin-3-yl)phenol?
The InChIKey is ZVCOSETYYFBCQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5FN4O/c9-6-1-5(2-7(14)3-6)8-12-10-4-11-13-8/h1-4,14H.
What are the key properties of 3-fluoro-5-(1,2,4,5-tetrazin-3-yl)phenol?
3-fluoro-5-(1,2,4,5-tetrazin-3-yl)phenol has a molecular weight of 192.15 g/mol, XLogP of 0.78, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-5-(1,2,4,5-tetrazin-3-yl)phenol is sourced from PubChem (CID 146637330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).