C27H28N4O3 — CID 146638176
N-(1-benzofuran-2-ylmethyl)-1-[2-[[(Z)-but-3-yn-2-ylideneamino]-methylamino]ethyl]-3,3-dimethyl-2-oxoindole-6-carboxamide (PubChem CID 146638176) has the molecular formula C27H28N4O3 and a molecular weight of 456.55 g/mol. Its IUPAC name is N-(1-benzofuran-2-ylmethyl)-1-[2-[[(Z)-but-3-yn-2-ylideneamino]-methylamino]ethyl]-3,3-dimethyl-2-oxoindole-6-carboxamide.
| Compound Name | N-(1-benzofuran-2-ylmethyl)-1-[2-[[(Z)-but-3-yn-2-ylideneamino]-methylamino]ethyl]-3,3-dimethyl-2-oxoindole-6-carboxamide |
|---|---|
| PubChem CID | 146638176 |
| Molecular Formula | C27H28N4O3 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | N-(1-benzofuran-2-ylmethyl)-1-[2-[[(Z)-but-3-yn-2-ylideneamino]-methylamino]ethyl]-3,3-dimethyl-2-oxoindole-6-carboxamide |
| SMILES | C#C/C(C)=N\N(C)CCN1C(=O)C(C)(C)c2ccc(C(=O)NCc3cc4ccccc4o3)cc21 |
| InChI | InChI=1S/C27H28N4O3/c1-6-18(2)29-30(5)13-14-31-23-16-20(11-12-22(23)27(3,4)26(31)33)25(32)28-17-21-15-19-9-7-8-10-24(19)34-21/h1,7-12,15-16H,13-14,17H2,2-5H3,(H,28,32)/b29-18- |
| InChIKey | AACPHXGDZGISFY-MIXAMLLLSA-N |
| XLogP | 3.93 |
| TPSA | 78.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|