C32H27FN4O5 — CID 146638191
methyl (4Z,6Z)-8-[2-(1,3-dioxoisoindol-2-yl)-6-fluoroquinolin-3-yl]oxy-7-methyl-3-methylidene-6-pyrazol-1-ylnona-4,6-dienoate (PubChem CID 146638191) has the molecular formula C32H27FN4O5 and a molecular weight of 566.59 g/mol. Its IUPAC name is methyl (4Z,6Z)-8-[2-(1,3-dioxoisoindol-2-yl)-6-fluoroquinolin-3-yl]oxy-7-methyl-3-methylidene-6-pyrazol-1-ylnona-4,6-dienoate.
| Compound Name | methyl (4Z,6Z)-8-[2-(1,3-dioxoisoindol-2-yl)-6-fluoroquinolin-3-yl]oxy-7-methyl-3-methylidene-6-pyrazol-1-ylnona-4,6-dienoate |
|---|---|
| PubChem CID | 146638191 |
| Molecular Formula | C32H27FN4O5 |
| Molecular Weight | 566.59 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | methyl (4Z,6Z)-8-[2-(1,3-dioxoisoindol-2-yl)-6-fluoroquinolin-3-yl]oxy-7-methyl-3-methylidene-6-pyrazol-1-ylnona-4,6-dienoate |
| SMILES | C=C(/C=C\C(=C(/C)C(C)Oc1cc2cc(F)ccc2nc1N1C(=O)c2ccccc2C1=O)n1cccn1)CC(=O)OC |
| InChI | InChI=1S/C32H27FN4O5/c1-19(16-29(38)41-4)10-13-27(36-15-7-14-34-36)20(2)21(3)42-28-18-22-17-23(33)11-12-26(22)35-30(28)37-31(39)24-8-5-6-9-25(24)32(37)40/h5-15,17-18,21H,1,16H2,2-4H3/b13-10-,27-20- |
| InChIKey | MZFHLHDVAQXCOM-VMAZLPDWSA-N |
| XLogP | 5.74 |
| TPSA | 103.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.59 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|