About 6-methyl-2-phenyl-1,2,4-triazaspiro[4.5]decan-3-one
6-methyl-2-phenyl-1,2,4-triazaspiro[4.5]decan-3-one (PubChem CID 14663839) has the molecular formula C14H19N3O
and a molecular weight of 245.33 g/mol. Its IUPAC name is 6-methyl-2-phenyl-1,2,4-triazaspiro[4.5]decan-3-one.
Molecular Properties
| Compound Name | 6-methyl-2-phenyl-1,2,4-triazaspiro[4.5]decan-3-one |
| PubChem CID | 14663839 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 6-methyl-2-phenyl-1,2,4-triazaspiro[4.5]decan-3-one |
| SMILES | CC1CCCCC12NC(=O)N(c1ccccc1)N2 |
| InChI | InChI=1S/C14H19N3O/c1-11-7-5-6-10-14(11)15-13(18)17(16-14)12-8-3-2-4-9-12/h2-4,8-9,11,16H,5-7,10H2,1H3,(H,15,18) |
| InChIKey | FZSVBEMYCOZBIE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methyl-2-phenyl-1,2,4-triazaspiro[4.5]decan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-phenyl-1,2,4-triazaspiro[4.5]decan-3-one?
The IUPAC name of 6-methyl-2-phenyl-1,2,4-triazaspiro[4.5]decan-3-one (CID 14663839) is 6-methyl-2-phenyl-1,2,4-triazaspiro[4.5]decan-3-one.
What is the SMILES notation for 6-methyl-2-phenyl-1,2,4-triazaspiro[4.5]decan-3-one?
The canonical SMILES for 6-methyl-2-phenyl-1,2,4-triazaspiro[4.5]decan-3-one is CC1CCCCC12NC(=O)N(c1ccccc1)N2.
What is the InChIKey of 6-methyl-2-phenyl-1,2,4-triazaspiro[4.5]decan-3-one?
The InChIKey is FZSVBEMYCOZBIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O/c1-11-7-5-6-10-14(11)15-13(18)17(16-14)12-8-3-2-4-9-12/h2-4,8-9,11,16H,5-7,10H2,1H3,(H,15,18).
What are the key properties of 6-methyl-2-phenyl-1,2,4-triazaspiro[4.5]decan-3-one?
6-methyl-2-phenyl-1,2,4-triazaspiro[4.5]decan-3-one has a molecular weight of 245.33 g/mol, XLogP of 2.63, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-phenyl-1,2,4-triazaspiro[4.5]decan-3-one is sourced from PubChem (CID 14663839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).