C28H31N5O5S — CID 146638448
N-[(1R,2S)-2-(1-hydroxyprop-2-enylamino)cyclopentyl]-7-[4-(oxan-4-yloxy)phenyl]-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 146638448) has the molecular formula C28H31N5O5S and a molecular weight of 549.65 g/mol. Its IUPAC name is N-[(1R,2S)-2-(1-hydroxyprop-2-enylamino)cyclopentyl]-7-[4-(oxan-4-yloxy)phenyl]-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | N-[(1R,2S)-2-(1-hydroxyprop-2-enylamino)cyclopentyl]-7-[4-(oxan-4-yloxy)phenyl]-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 146638448 |
| Molecular Formula | C28H31N5O5S |
| Molecular Weight | 549.65 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | N-[(1R,2S)-2-(1-hydroxyprop-2-enylamino)cyclopentyl]-7-[4-(oxan-4-yloxy)phenyl]-6-oxo-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | C=CC(O)N[C@H]1CCC[C@H]1NC(=O)c1sc2nccc3c2c1NC(=O)N3c1ccc(OC2CCOCC2)cc1 |
| InChI | InChI=1S/C28H31N5O5S/c1-2-22(34)30-19-4-3-5-20(19)31-26(35)25-24-23-21(10-13-29-27(23)39-25)33(28(36)32-24)16-6-8-17(9-7-16)38-18-11-14-37-15-12-18/h2,6-10,13,18-20,22,30,34H,1,3-5,11-12,14-15H2,(H,31,35)(H,32,36)/t19-,20+,22?/m0/s1 |
| InChIKey | QEGNHJYNQVDSDX-RJKSWSIASA-N |
| XLogP | 4.28 |
| TPSA | 125.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.65 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|