About (2Z,4Z)-2-(ethylideneamino)hepta-2,4-diene-4-thiol
(2Z,4Z)-2-(ethylideneamino)hepta-2,4-diene-4-thiol (PubChem CID 146638492) has the molecular formula C9H15NS
and a molecular weight of 169.29 g/mol. Its IUPAC name is (2Z,4Z)-2-(ethylideneamino)hepta-2,4-diene-4-thiol.
Molecular Properties
| Compound Name | (2Z,4Z)-2-(ethylideneamino)hepta-2,4-diene-4-thiol |
| PubChem CID | 146638492 |
| Molecular Formula | C9H15NS |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | (2Z,4Z)-2-(ethylideneamino)hepta-2,4-diene-4-thiol |
| SMILES | C/C=N/C(C)=C\C(S)=C\CC |
| InChI | InChI=1S/C9H15NS/c1-4-6-9(11)7-8(3)10-5-2/h5-7,11H,4H2,1-3H3/b8-7-,9-6-,10-5+ |
| InChIKey | RNLMJCJBSSDKCZ-CEWXQRBCSA-N |
| XLogP | 3.20 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4Z)-2-(ethylideneamino)hepta-2,4-diene-4-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4Z)-2-(ethylideneamino)hepta-2,4-diene-4-thiol?
The IUPAC name of (2Z,4Z)-2-(ethylideneamino)hepta-2,4-diene-4-thiol (CID 146638492) is (2Z,4Z)-2-(ethylideneamino)hepta-2,4-diene-4-thiol.
What is the SMILES notation for (2Z,4Z)-2-(ethylideneamino)hepta-2,4-diene-4-thiol?
The canonical SMILES for (2Z,4Z)-2-(ethylideneamino)hepta-2,4-diene-4-thiol is C/C=N/C(C)=C\C(S)=C\CC.
What is the InChIKey of (2Z,4Z)-2-(ethylideneamino)hepta-2,4-diene-4-thiol?
The InChIKey is RNLMJCJBSSDKCZ-CEWXQRBCSA-N. The full InChI is InChI=1S/C9H15NS/c1-4-6-9(11)7-8(3)10-5-2/h5-7,11H,4H2,1-3H3/b8-7-,9-6-,10-5+.
What are the key properties of (2Z,4Z)-2-(ethylideneamino)hepta-2,4-diene-4-thiol?
(2Z,4Z)-2-(ethylideneamino)hepta-2,4-diene-4-thiol has a molecular weight of 169.29 g/mol, XLogP of 3.20, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4Z)-2-(ethylideneamino)hepta-2,4-diene-4-thiol is sourced from PubChem (CID 146638492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).