C22H26FN3O — CID 146639472
N-tert-butyl-7'-fluoro-2-methylspiro[1,2,4-oxadiazole-5,2'-tricyclo[10.4.0.03,8]hexadeca-1(16),3(8),4,6,12,14-hexaene]-3-amine (PubChem CID 146639472) has the molecular formula C22H26FN3O and a molecular weight of 367.47 g/mol. Its IUPAC name is N-tert-butyl-7'-fluoro-2-methylspiro[1,2,4-oxadiazole-5,2'-tricyclo[10.4.0.03,8]hexadeca-1(16),3(8),4,6,12,14-hexaene]-3-amine.
| Compound Name | N-tert-butyl-7'-fluoro-2-methylspiro[1,2,4-oxadiazole-5,2'-tricyclo[10.4.0.03,8]hexadeca-1(16),3(8),4,6,12,14-hexaene]-3-amine |
|---|---|
| PubChem CID | 146639472 |
| Molecular Formula | C22H26FN3O |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | N-tert-butyl-7'-fluoro-2-methylspiro[1,2,4-oxadiazole-5,2'-tricyclo[10.4.0.03,8]hexadeca-1(16),3(8),4,6,12,14-hexaene]-3-amine |
| SMILES | CN1OC2(N=C1NC(C)(C)C)c1ccccc1CCCc1c(F)cccc12 |
| InChI | InChI=1S/C22H26FN3O/c1-21(2,3)24-20-25-22(27-26(20)4)17-12-6-5-9-15(17)10-7-11-16-18(22)13-8-14-19(16)23/h5-6,8-9,12-14H,7,10-11H2,1-4H3,(H,24,25) |
| InChIKey | HKQNGKYOHQTMLK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |