C23H28FN3O — CID 146639662
N-tert-butyl-7'-fluoro-N,2-dimethylspiro[1,2,4-oxadiazole-5,2'-tricyclo[10.4.0.03,8]hexadeca-1(16),3(8),4,6,12,14-hexaene]-3-amine (PubChem CID 146639662) has the molecular formula C23H28FN3O and a molecular weight of 381.50 g/mol. Its IUPAC name is N-tert-butyl-7'-fluoro-N,2-dimethylspiro[1,2,4-oxadiazole-5,2'-tricyclo[10.4.0.03,8]hexadeca-1(16),3(8),4,6,12,14-hexaene]-3-amine.
| Compound Name | N-tert-butyl-7'-fluoro-N,2-dimethylspiro[1,2,4-oxadiazole-5,2'-tricyclo[10.4.0.03,8]hexadeca-1(16),3(8),4,6,12,14-hexaene]-3-amine |
|---|---|
| PubChem CID | 146639662 |
| Molecular Formula | C23H28FN3O |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | N-tert-butyl-7'-fluoro-N,2-dimethylspiro[1,2,4-oxadiazole-5,2'-tricyclo[10.4.0.03,8]hexadeca-1(16),3(8),4,6,12,14-hexaene]-3-amine |
| SMILES | CN1OC2(N=C1N(C)C(C)(C)C)c1ccccc1CCCc1c(F)cccc12 |
| InChI | InChI=1S/C23H28FN3O/c1-22(2,3)26(4)21-25-23(28-27(21)5)18-13-7-6-10-16(18)11-8-12-17-19(23)14-9-15-20(17)24/h6-7,9-10,13-15H,8,11-12H2,1-5H3 |
| InChIKey | YTZZKAYCDDTASR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |