About 3-(4-fluorophenyl)phenol
3-(4-fluorophenyl)phenol (PubChem CID 14663967) has the molecular formula C12H9FO
and a molecular weight of 188.20 g/mol. Its IUPAC name is 3-(4-fluorophenyl)phenol.
Molecular Properties
| Compound Name | 3-(4-fluorophenyl)phenol |
| PubChem CID | 14663967 |
| Molecular Formula | C12H9FO |
| Molecular Weight | 188.20 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 3-(4-fluorophenyl)phenol |
| SMILES | Oc1cccc(-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C12H9FO/c13-11-6-4-9(5-7-11)10-2-1-3-12(14)8-10/h1-8,14H |
| InChIKey | JCZGBYKFVYILAO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.20 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(4-fluorophenyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluorophenyl)phenol?
The IUPAC name of 3-(4-fluorophenyl)phenol (CID 14663967) is 3-(4-fluorophenyl)phenol.
What is the SMILES notation for 3-(4-fluorophenyl)phenol?
The canonical SMILES for 3-(4-fluorophenyl)phenol is Oc1cccc(-c2ccc(F)cc2)c1.
What is the InChIKey of 3-(4-fluorophenyl)phenol?
The InChIKey is JCZGBYKFVYILAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9FO/c13-11-6-4-9(5-7-11)10-2-1-3-12(14)8-10/h1-8,14H.
What are the key properties of 3-(4-fluorophenyl)phenol?
3-(4-fluorophenyl)phenol has a molecular weight of 188.20 g/mol, XLogP of 3.20, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorophenyl)phenol is sourced from PubChem (CID 14663967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).