C18H20FN3O5 — CID 146640438
3-[5-fluoro-1-hydroxy-6-[(3R)-3-(hydroxymethyl)pyrrolidin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 146640438) has the molecular formula C18H20FN3O5 and a molecular weight of 377.37 g/mol. Its IUPAC name is 3-[5-fluoro-1-hydroxy-6-[(3R)-3-(hydroxymethyl)pyrrolidin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-fluoro-1-hydroxy-6-[(3R)-3-(hydroxymethyl)pyrrolidin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146640438 |
| Molecular Formula | C18H20FN3O5 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 3-[5-fluoro-1-hydroxy-6-[(3R)-3-(hydroxymethyl)pyrrolidin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2C(=O)c3cc(F)c(N4CC[C@@H](CO)C4)cc3C2O)C(=O)N1 |
| InChI | InChI=1S/C18H20FN3O5/c19-12-5-10-11(6-14(12)21-4-3-9(7-21)8-23)18(27)22(17(10)26)13-1-2-15(24)20-16(13)25/h5-6,9,13,18,23,27H,1-4,7-8H2,(H,20,24,25)/t9-,13?,18?/m1/s1 |
| InChIKey | GDXVUGZOBCBNLQ-IMNAFSGVSA-N |
| XLogP | -0.10 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|