C10H18FN — CID 146640795
2-ethyl-6-(1-fluoroethyl)-5-methyl-1,2,3,6-tetrahydropyridine (PubChem CID 146640795) has the molecular formula C10H18FN and a molecular weight of 171.26 g/mol. Its IUPAC name is 2-ethyl-6-(1-fluoroethyl)-5-methyl-1,2,3,6-tetrahydropyridine.
| Compound Name | 2-ethyl-6-(1-fluoroethyl)-5-methyl-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 146640795 |
| Molecular Formula | C10H18FN |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | 2-ethyl-6-(1-fluoroethyl)-5-methyl-1,2,3,6-tetrahydropyridine |
| SMILES | CCC1CC=C(C)C(C(C)F)N1 |
| InChI | InChI=1S/C10H18FN/c1-4-9-6-5-7(2)10(12-9)8(3)11/h5,8-10,12H,4,6H2,1-3H3 |
| InChIKey | MAGJIPNYWATAOD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|