1,3-bis(trifluoromethoxy)propan-2-yl 2,2-dimethylpropanoate

C10H14F6O4 — CID 146641183

IUPAC1,3-bis(trifluoromethoxy)propan-2-yl 2,2-dimethylpropanoate
SMILESCC(C)(C)C(=O)OC(COC(F)(F)F)COC(F)(F)F
InChIInChI=1S/C10H14F6O4/c1-8(2,3)7(17)20-6(4-18-9(11,12)13)5-19-10(14,15)16/h6H,4-5H2,1-3H3
InChIKeyKKJIZEOUWGLZHM-UHFFFAOYSA-N
MW312.21 g/mol
LogP3.02
Rot. Bonds5

About 1,3-bis(trifluoromethoxy)propan-2-yl 2,2-dimethylpropanoate

1,3-bis(trifluoromethoxy)propan-2-yl 2,2-dimethylpropanoate (PubChem CID 146641183) has the molecular formula C10H14F6O4 and a molecular weight of 312.21 g/mol. Its IUPAC name is 1,3-bis(trifluoromethoxy)propan-2-yl 2,2-dimethylpropanoate.

Molecular Properties

Compound Name1,3-bis(trifluoromethoxy)propan-2-yl 2,2-dimethylpropanoate
PubChem CID146641183
Molecular FormulaC10H14F6O4
Molecular Weight312.21 g/mol
Exact Mass312.08
IUPAC Name1,3-bis(trifluoromethoxy)propan-2-yl 2,2-dimethylpropanoate
SMILESCC(C)(C)C(=O)OC(COC(F)(F)F)COC(F)(F)F
InChIInChI=1S/C10H14F6O4/c1-8(2,3)7(17)20-6(4-18-9(11,12)13)5-19-10(14,15)16/h6H,4-5H2,1-3H3
InChIKeyKKJIZEOUWGLZHM-UHFFFAOYSA-N
XLogP3.02
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500312.21
LogP ≤ 53.02
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 1,3-bis(trifluoromethoxy)propan-2-yl 2,2-dimethylpropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-bis(trifluoromethoxy)propan-2-yl 2,2-dimethylpropanoate?
The IUPAC name of 1,3-bis(trifluoromethoxy)propan-2-yl 2,2-dimethylpropanoate (CID 146641183) is 1,3-bis(trifluoromethoxy)propan-2-yl 2,2-dimethylpropanoate.
What is the SMILES notation for 1,3-bis(trifluoromethoxy)propan-2-yl 2,2-dimethylpropanoate?
The canonical SMILES for 1,3-bis(trifluoromethoxy)propan-2-yl 2,2-dimethylpropanoate is CC(C)(C)C(=O)OC(COC(F)(F)F)COC(F)(F)F.
What is the InChIKey of 1,3-bis(trifluoromethoxy)propan-2-yl 2,2-dimethylpropanoate?
The InChIKey is KKJIZEOUWGLZHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F6O4/c1-8(2,3)7(17)20-6(4-18-9(11,12)13)5-19-10(14,15)16/h6H,4-5H2,1-3H3.
What are the key properties of 1,3-bis(trifluoromethoxy)propan-2-yl 2,2-dimethylpropanoate?
1,3-bis(trifluoromethoxy)propan-2-yl 2,2-dimethylpropanoate has a molecular weight of 312.21 g/mol, XLogP of 3.02, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(trifluoromethoxy)propan-2-yl 2,2-dimethylpropanoate is sourced from PubChem (CID 146641183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).