C39H34N8O4 — CID 146641549
6-[6-[5-[[4-(dimethylamino)phenyl]diazenyl]-1H-indole-2-carbonyl]-2,3,7,8-tetrahydro-1H-pyrrolo[3,2-e]indole-2-carbonyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylic acid (PubChem CID 146641549) has the molecular formula C39H34N8O4 and a molecular weight of 678.75 g/mol. Its IUPAC name is 6-[6-[5-[[4-(dimethylamino)phenyl]diazenyl]-1H-indole-2-carbonyl]-2,3,7,8-tetrahydro-1H-pyrrolo[3,2-e]indole-2-carbonyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylic acid.
| Compound Name | 6-[6-[5-[[4-(dimethylamino)phenyl]diazenyl]-1H-indole-2-carbonyl]-2,3,7,8-tetrahydro-1H-pyrrolo[3,2-e]indole-2-carbonyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 146641549 |
| Molecular Formula | C39H34N8O4 |
| Molecular Weight | 678.75 g/mol |
| Exact Mass | 678.27 |
| IUPAC Name | 6-[6-[5-[[4-(dimethylamino)phenyl]diazenyl]-1H-indole-2-carbonyl]-2,3,7,8-tetrahydro-1H-pyrrolo[3,2-e]indole-2-carbonyl]-7,8-dihydro-3H-pyrrolo[3,2-e]indole-2-carboxylic acid |
| SMILES | CN(C)c1ccc(/N=N/c2ccc3[nH]c(C(=O)N4CCc5c4ccc4c5CC(C(=O)N5CCc6c5ccc5[nH]c(C(=O)O)cc65)N4)cc3c2)cc1 |
| InChI | InChI=1S/C39H34N8O4/c1-45(2)24-6-3-22(4-7-24)43-44-23-5-8-29-21(17-23)18-32(40-29)37(48)46-15-13-25-27-19-33(41-30(27)9-11-35(25)46)38(49)47-16-14-26-28-20-34(39(50)51)42-31(28)10-12-36(26)47/h3-12,17-18,20,33,40-42H,13-16,19H2,1-2H3,(H,50,51)/b44-43+ |
| InChIKey | NLHPFQCGLXLWRJ-VGFSZAGXSA-N |
| XLogP | 6.96 |
| TPSA | 149.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.75 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|