C18H27NO4 — CID 146641691
tert-butyl (4S)-6-[(1Z)-3-methoxycarbonylbuta-1,3-dienyl]-4,5-dimethyl-3,4-dihydro-2H-pyridine-1-carboxylate (PubChem CID 146641691) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is tert-butyl (4S)-6-[(1Z)-3-methoxycarbonylbuta-1,3-dienyl]-4,5-dimethyl-3,4-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl (4S)-6-[(1Z)-3-methoxycarbonylbuta-1,3-dienyl]-4,5-dimethyl-3,4-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 146641691 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | tert-butyl (4S)-6-[(1Z)-3-methoxycarbonylbuta-1,3-dienyl]-4,5-dimethyl-3,4-dihydro-2H-pyridine-1-carboxylate |
| SMILES | C=C(/C=C\C1=C(C)[C@@H](C)CCN1C(=O)OC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C18H27NO4/c1-12-10-11-19(17(21)23-18(4,5)6)15(14(12)3)9-8-13(2)16(20)22-7/h8-9,12H,2,10-11H2,1,3-7H3/b9-8-/t12-/m0/s1 |
| InChIKey | HVZOSPKWHAUWMH-LAUAKBEESA-N |
| XLogP | 3.82 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|