C19H22N4O3 — CID 146641781
9-[2-(1,3-benzodioxol-5-yl)ethylamino]-3,4,7,8,9,10-hexahydro-2H-pyrazino[1,2-b]indazol-1-one (PubChem CID 146641781) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 9-[2-(1,3-benzodioxol-5-yl)ethylamino]-3,4,7,8,9,10-hexahydro-2H-pyrazino[1,2-b]indazol-1-one.
| Compound Name | 9-[2-(1,3-benzodioxol-5-yl)ethylamino]-3,4,7,8,9,10-hexahydro-2H-pyrazino[1,2-b]indazol-1-one |
|---|---|
| PubChem CID | 146641781 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 9-[2-(1,3-benzodioxol-5-yl)ethylamino]-3,4,7,8,9,10-hexahydro-2H-pyrazino[1,2-b]indazol-1-one |
| SMILES | O=C1NCCn2nc3c(c21)CC(NCCc1ccc2c(c1)OCO2)CC3 |
| InChI | InChI=1S/C19H22N4O3/c24-19-18-14-10-13(2-3-15(14)22-23(18)8-7-21-19)20-6-5-12-1-4-16-17(9-12)26-11-25-16/h1,4,9,13,20H,2-3,5-8,10-11H2,(H,21,24) |
| InChIKey | IPUFGTOCPBVIBM-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |