About 2,2-dimethylpiperazine
2,2-dimethylpiperazine (PubChem CID 14664186) has the molecular formula C6H14N2
and a molecular weight of 114.19 g/mol. Its IUPAC name is 2,2-dimethylpiperazine.
Molecular Properties
| Compound Name | 2,2-dimethylpiperazine |
| PubChem CID | 14664186 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | 2,2-dimethylpiperazine |
| SMILES | CC1(C)CNCCN1 |
| InChI | InChI=1S/C6H14N2/c1-6(2)5-7-3-4-8-6/h7-8H,3-5H2,1-2H3 |
| InChIKey | PIPWSBOFSUJCCO-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpiperazine?
The IUPAC name of 2,2-dimethylpiperazine (CID 14664186) is 2,2-dimethylpiperazine.
What is the SMILES notation for 2,2-dimethylpiperazine?
The canonical SMILES for 2,2-dimethylpiperazine is CC1(C)CNCCN1.
What is the InChIKey of 2,2-dimethylpiperazine?
The InChIKey is PIPWSBOFSUJCCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2/c1-6(2)5-7-3-4-8-6/h7-8H,3-5H2,1-2H3.
What are the key properties of 2,2-dimethylpiperazine?
2,2-dimethylpiperazine has a molecular weight of 114.19 g/mol, XLogP of -0.04, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpiperazine is sourced from PubChem (CID 14664186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).