About cis-(1S,2R)-2-(diethylaminomethyl)cyclohexan-1-ol
cis-(1S,2R)-2-(diethylaminomethyl)cyclohexan-1-ol (PubChem CID 14664228) has the molecular formula C11H23NO
and a molecular weight of 185.31 g/mol. Its IUPAC name is cis-(1S,2R)-2-(diethylaminomethyl)cyclohexan-1-ol.
Molecular Properties
| Compound Name | cis-(1S,2R)-2-(diethylaminomethyl)cyclohexan-1-ol |
| PubChem CID | 14664228 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | cis-(1S,2R)-2-(diethylaminomethyl)cyclohexan-1-ol |
| SMILES | CCN(CC)C[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C11H23NO/c1-3-12(4-2)9-10-7-5-6-8-11(10)13/h10-11,13H,3-9H2,1-2H3/t10-,11+/m1/s1 |
| InChIKey | VCEINMUJRXFIFV-MNOVXSKESA-N |
| XLogP | 1.88 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cis-(1S,2R)-2-(diethylaminomethyl)cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,2R)-2-(diethylaminomethyl)cyclohexan-1-ol?
The IUPAC name of cis-(1S,2R)-2-(diethylaminomethyl)cyclohexan-1-ol (CID 14664228) is cis-(1S,2R)-2-(diethylaminomethyl)cyclohexan-1-ol.
What is the SMILES notation for cis-(1S,2R)-2-(diethylaminomethyl)cyclohexan-1-ol?
The canonical SMILES for cis-(1S,2R)-2-(diethylaminomethyl)cyclohexan-1-ol is CCN(CC)C[C@H]1CCCC[C@@H]1O.
What is the InChIKey of cis-(1S,2R)-2-(diethylaminomethyl)cyclohexan-1-ol?
The InChIKey is VCEINMUJRXFIFV-MNOVXSKESA-N. The full InChI is InChI=1S/C11H23NO/c1-3-12(4-2)9-10-7-5-6-8-11(10)13/h10-11,13H,3-9H2,1-2H3/t10-,11+/m1/s1.
What are the key properties of cis-(1S,2R)-2-(diethylaminomethyl)cyclohexan-1-ol?
cis-(1S,2R)-2-(diethylaminomethyl)cyclohexan-1-ol has a molecular weight of 185.31 g/mol, XLogP of 1.88, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2R)-2-(diethylaminomethyl)cyclohexan-1-ol is sourced from PubChem (CID 14664228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).