About (3Z,5E)-5-amino-7-fluoro-2-methylidenehepta-3,5-dienenitrile
(3Z,5E)-5-amino-7-fluoro-2-methylidenehepta-3,5-dienenitrile (PubChem CID 146642451) has the molecular formula C8H9FN2
and a molecular weight of 152.17 g/mol. Its IUPAC name is (3Z,5E)-5-amino-7-fluoro-2-methylidenehepta-3,5-dienenitrile.
Molecular Properties
| Compound Name | (3Z,5E)-5-amino-7-fluoro-2-methylidenehepta-3,5-dienenitrile |
| PubChem CID | 146642451 |
| Molecular Formula | C8H9FN2 |
| Molecular Weight | 152.17 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | (3Z,5E)-5-amino-7-fluoro-2-methylidenehepta-3,5-dienenitrile |
| SMILES | C=C(C#N)/C=C\C(N)=C/CF |
| InChI | InChI=1S/C8H9FN2/c1-7(6-10)2-3-8(11)4-5-9/h2-4H,1,5,11H2/b3-2-,8-4+ |
| InChIKey | CMGWQEZWTNNCGC-SOBRUKQLSA-N |
| XLogP | 1.43 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.17 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z,5E)-5-amino-7-fluoro-2-methylidenehepta-3,5-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5E)-5-amino-7-fluoro-2-methylidenehepta-3,5-dienenitrile?
The IUPAC name of (3Z,5E)-5-amino-7-fluoro-2-methylidenehepta-3,5-dienenitrile (CID 146642451) is (3Z,5E)-5-amino-7-fluoro-2-methylidenehepta-3,5-dienenitrile.
What is the SMILES notation for (3Z,5E)-5-amino-7-fluoro-2-methylidenehepta-3,5-dienenitrile?
The canonical SMILES for (3Z,5E)-5-amino-7-fluoro-2-methylidenehepta-3,5-dienenitrile is C=C(C#N)/C=C\C(N)=C/CF.
What is the InChIKey of (3Z,5E)-5-amino-7-fluoro-2-methylidenehepta-3,5-dienenitrile?
The InChIKey is CMGWQEZWTNNCGC-SOBRUKQLSA-N. The full InChI is InChI=1S/C8H9FN2/c1-7(6-10)2-3-8(11)4-5-9/h2-4H,1,5,11H2/b3-2-,8-4+.
What are the key properties of (3Z,5E)-5-amino-7-fluoro-2-methylidenehepta-3,5-dienenitrile?
(3Z,5E)-5-amino-7-fluoro-2-methylidenehepta-3,5-dienenitrile has a molecular weight of 152.17 g/mol, XLogP of 1.43, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5E)-5-amino-7-fluoro-2-methylidenehepta-3,5-dienenitrile is sourced from PubChem (CID 146642451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).