About 1-(4-butylphenyl)-3-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)urea
1-(4-butylphenyl)-3-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)urea (PubChem CID 146642504) has the molecular formula C18H19FN4O
and a molecular weight of 326.38 g/mol. Its IUPAC name is 1-(4-butylphenyl)-3-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)urea.
Molecular Properties
| Compound Name | 1-(4-butylphenyl)-3-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)urea |
| PubChem CID | 146642504 |
| Molecular Formula | C18H19FN4O |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 1-(4-butylphenyl)-3-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)urea |
| SMILES | CCCCc1ccc(NC(=O)Nc2c[nH]c3ncc(F)cc23)cc1 |
| InChI | InChI=1S/C18H19FN4O/c1-2-3-4-12-5-7-14(8-6-12)22-18(24)23-16-11-21-17-15(16)9-13(19)10-20-17/h5-11H,2-4H2,1H3,(H,20,21)(H2,22,23,24) |
| InChIKey | IEQQEJVJHKVJDF-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-butylphenyl)-3-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-butylphenyl)-3-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)urea?
The IUPAC name of 1-(4-butylphenyl)-3-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)urea (CID 146642504) is 1-(4-butylphenyl)-3-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)urea.
What is the SMILES notation for 1-(4-butylphenyl)-3-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)urea?
The canonical SMILES for 1-(4-butylphenyl)-3-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)urea is CCCCc1ccc(NC(=O)Nc2c[nH]c3ncc(F)cc23)cc1.
What is the InChIKey of 1-(4-butylphenyl)-3-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)urea?
The InChIKey is IEQQEJVJHKVJDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19FN4O/c1-2-3-4-12-5-7-14(8-6-12)22-18(24)23-16-11-21-17-15(16)9-13(19)10-20-17/h5-11H,2-4H2,1H3,(H,20,21)(H2,22,23,24).
What are the key properties of 1-(4-butylphenyl)-3-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)urea?
1-(4-butylphenyl)-3-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)urea has a molecular weight of 326.38 g/mol, XLogP of 4.69, 5 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-butylphenyl)-3-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)urea is sourced from PubChem (CID 146642504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).