C16H29N3 — CID 146642727
(3Z)-5-(3-aminobut-3-en-2-yl)-N',2,2-trimethylnona-3,6-dienimidamide (PubChem CID 146642727) has the molecular formula C16H29N3 and a molecular weight of 263.43 g/mol. Its IUPAC name is (3Z)-5-(3-aminobut-3-en-2-yl)-N',2,2-trimethylnona-3,6-dienimidamide.
| Compound Name | (3Z)-5-(3-aminobut-3-en-2-yl)-N',2,2-trimethylnona-3,6-dienimidamide |
|---|---|
| PubChem CID | 146642727 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | (3Z)-5-(3-aminobut-3-en-2-yl)-N',2,2-trimethylnona-3,6-dienimidamide |
| SMILES | C=C(N)C(C)C(C=CCC)/C=C\C(C)(C)/C(N)=N/C |
| InChI | InChI=1S/C16H29N3/c1-7-8-9-14(12(2)13(3)17)10-11-16(4,5)15(18)19-6/h8-12,14H,3,7,17H2,1-2,4-6H3,(H2,18,19)/b9-8?,11-10- |
| InChIKey | GPWZBPCKDNDWSQ-HWDIUJSMSA-N |
| XLogP | 3.25 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|