C18H16F3N3O — CID 146642760
N-[(3-amino-6-cyclopropyl-2-methanimidoylphenyl)methyl]-3,4,5-trifluorobenzamide (PubChem CID 146642760) has the molecular formula C18H16F3N3O and a molecular weight of 347.34 g/mol. Its IUPAC name is N-[(3-amino-6-cyclopropyl-2-methanimidoylphenyl)methyl]-3,4,5-trifluorobenzamide.
| Compound Name | N-[(3-amino-6-cyclopropyl-2-methanimidoylphenyl)methyl]-3,4,5-trifluorobenzamide |
|---|---|
| PubChem CID | 146642760 |
| Molecular Formula | C18H16F3N3O |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | N-[(3-amino-6-cyclopropyl-2-methanimidoylphenyl)methyl]-3,4,5-trifluorobenzamide |
| SMILES | [H]/N=C/c1c(N)ccc(C2CC2)c1CNC(=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C18H16F3N3O/c19-14-5-10(6-15(20)17(14)21)18(25)24-8-13-11(9-1-2-9)3-4-16(23)12(13)7-22/h3-7,9,22H,1-2,8,23H2,(H,24,25)/b22-7+ |
| InChIKey | DWOLCKWMBFBENL-QPJQQBGISA-N |
| XLogP | 3.49 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|