C6H5N5O — CID 146642886
7-isocyanato-2-methyl-3H-pyrazolo[1,5-b][1,2,4]triazole (PubChem CID 146642886) has the molecular formula C6H5N5O and a molecular weight of 163.14 g/mol. Its IUPAC name is 7-isocyanato-2-methyl-3H-pyrazolo[1,5-b][1,2,4]triazole.
| Compound Name | 7-isocyanato-2-methyl-3H-pyrazolo[1,5-b][1,2,4]triazole |
|---|---|
| PubChem CID | 146642886 |
| Molecular Formula | C6H5N5O |
| Molecular Weight | 163.14 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | 7-isocyanato-2-methyl-3H-pyrazolo[1,5-b][1,2,4]triazole |
| SMILES | Cc1nc2c(N=C=O)cnn2[nH]1 |
| InChI | InChI=1S/C6H5N5O/c1-4-9-6-5(7-3-12)2-8-11(6)10-4/h2H,1H3,(H,9,10) |
| InChIKey | JOXKANZJUOMRSW-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 75.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.14 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|