About 2-(aminomethyl)-3-[(3,5-difluoro-4-methoxyanilino)methyl]-4-ethylaniline
2-(aminomethyl)-3-[(3,5-difluoro-4-methoxyanilino)methyl]-4-ethylaniline (PubChem CID 146642991) has the molecular formula C17H21F2N3O
and a molecular weight of 321.37 g/mol. Its IUPAC name is 2-(aminomethyl)-3-[(3,5-difluoro-4-methoxyanilino)methyl]-4-ethylaniline.
Molecular Properties
| Compound Name | 2-(aminomethyl)-3-[(3,5-difluoro-4-methoxyanilino)methyl]-4-ethylaniline |
| PubChem CID | 146642991 |
| Molecular Formula | C17H21F2N3O |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 2-(aminomethyl)-3-[(3,5-difluoro-4-methoxyanilino)methyl]-4-ethylaniline |
| SMILES | CCc1ccc(N)c(CN)c1CNc1cc(F)c(OC)c(F)c1 |
| InChI | InChI=1S/C17H21F2N3O/c1-3-10-4-5-16(21)12(8-20)13(10)9-22-11-6-14(18)17(23-2)15(19)7-11/h4-7,22H,3,8-9,20-21H2,1-2H3 |
| InChIKey | GPEGNLOTTWJBAC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(aminomethyl)-3-[(3,5-difluoro-4-methoxyanilino)methyl]-4-ethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-3-[(3,5-difluoro-4-methoxyanilino)methyl]-4-ethylaniline?
The IUPAC name of 2-(aminomethyl)-3-[(3,5-difluoro-4-methoxyanilino)methyl]-4-ethylaniline (CID 146642991) is 2-(aminomethyl)-3-[(3,5-difluoro-4-methoxyanilino)methyl]-4-ethylaniline.
What is the SMILES notation for 2-(aminomethyl)-3-[(3,5-difluoro-4-methoxyanilino)methyl]-4-ethylaniline?
The canonical SMILES for 2-(aminomethyl)-3-[(3,5-difluoro-4-methoxyanilino)methyl]-4-ethylaniline is CCc1ccc(N)c(CN)c1CNc1cc(F)c(OC)c(F)c1.
What is the InChIKey of 2-(aminomethyl)-3-[(3,5-difluoro-4-methoxyanilino)methyl]-4-ethylaniline?
The InChIKey is GPEGNLOTTWJBAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21F2N3O/c1-3-10-4-5-16(21)12(8-20)13(10)9-22-11-6-14(18)17(23-2)15(19)7-11/h4-7,22H,3,8-9,20-21H2,1-2H3.
What are the key properties of 2-(aminomethyl)-3-[(3,5-difluoro-4-methoxyanilino)methyl]-4-ethylaniline?
2-(aminomethyl)-3-[(3,5-difluoro-4-methoxyanilino)methyl]-4-ethylaniline has a molecular weight of 321.37 g/mol, XLogP of 3.19, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-3-[(3,5-difluoro-4-methoxyanilino)methyl]-4-ethylaniline is sourced from PubChem (CID 146642991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).