C30H34ClF2IN4O6S3 — CID 146643200
methyl 4-(2-chloro-3,4-difluorophenyl)-6-[1-[4-(2-iodosulfanylethoxycarbonyl)-4-methylcyclohexyl]sulfonylpiperidin-4-yl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 146643200) has the molecular formula C30H34ClF2IN4O6S3 and a molecular weight of 843.18 g/mol. Its IUPAC name is methyl 4-(2-chloro-3,4-difluorophenyl)-6-[1-[4-(2-iodosulfanylethoxycarbonyl)-4-methylcyclohexyl]sulfonylpiperidin-4-yl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | methyl 4-(2-chloro-3,4-difluorophenyl)-6-[1-[4-(2-iodosulfanylethoxycarbonyl)-4-methylcyclohexyl]sulfonylpiperidin-4-yl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 146643200 |
| Molecular Formula | C30H34ClF2IN4O6S3 |
| Molecular Weight | 843.18 g/mol |
| Exact Mass | 842.03 |
| IUPAC Name | methyl 4-(2-chloro-3,4-difluorophenyl)-6-[1-[4-(2-iodosulfanylethoxycarbonyl)-4-methylcyclohexyl]sulfonylpiperidin-4-yl]-2-(1,3-thiazol-2-yl)-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | COC(=O)C1=C(C2CCN(S(=O)(=O)C3CCC(C)(C(=O)OCCSI)CC3)CC2)NC(c2nccs2)=NC1c1ccc(F)c(F)c1Cl |
| InChI | InChI=1S/C30H34ClF2IN4O6S3/c1-30(29(40)44-14-16-46-34)9-5-18(6-10-30)47(41,42)38-12-7-17(8-13-38)24-21(28(39)43-2)25(19-3-4-20(32)23(33)22(19)31)37-26(36-24)27-35-11-15-45-27/h3-4,11,15,17-18,25H,5-10,12-14,16H2,1-2H3,(H,36,37) |
| InChIKey | MEBZQAHEBUIELV-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 127.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.18 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|