C26H32N2 — CID 146643581
4-[(3E,5E,9Z,12E,14Z)-3-amino-7,12-dimethyl-8,11-dimethylidenehexadeca-1,3,5,9,12,14-hexaen-7-yl]aniline (PubChem CID 146643581) has the molecular formula C26H32N2 and a molecular weight of 372.56 g/mol. Its IUPAC name is 4-[(3E,5E,9Z,12E,14Z)-3-amino-7,12-dimethyl-8,11-dimethylidenehexadeca-1,3,5,9,12,14-hexaen-7-yl]aniline.
| Compound Name | 4-[(3E,5E,9Z,12E,14Z)-3-amino-7,12-dimethyl-8,11-dimethylidenehexadeca-1,3,5,9,12,14-hexaen-7-yl]aniline |
|---|---|
| PubChem CID | 146643581 |
| Molecular Formula | C26H32N2 |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | 4-[(3E,5E,9Z,12E,14Z)-3-amino-7,12-dimethyl-8,11-dimethylidenehexadeca-1,3,5,9,12,14-hexaen-7-yl]aniline |
| SMILES | C=C/C(N)=C\C=C\C(C)(C(=C)/C=C\C(=C)/C(C)=C/C=C\C)c1ccc(N)cc1 |
| InChI | InChI=1S/C26H32N2/c1-7-9-11-20(3)21(4)13-14-22(5)26(6,19-10-12-24(27)8-2)23-15-17-25(28)18-16-23/h7-19H,2,4-5,27-28H2,1,3,6H3/b9-7-,14-13-,19-10+,20-11+,24-12+ |
| InChIKey | OBRPTIRZUJWWSC-IEZVDAPJSA-N |
| XLogP | 6.30 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|