C21H26F2N4O — CID 146643591
N-[(3S,4R)-4-[6-(1,1-difluoroethyl)-3-pyridinyl]pyrrolidin-3-yl]-2-[4-(dimethylamino)phenyl]acetamide (PubChem CID 146643591) has the molecular formula C21H26F2N4O and a molecular weight of 388.46 g/mol. Its IUPAC name is N-[(3S,4R)-4-[6-(1,1-difluoroethyl)-3-pyridinyl]pyrrolidin-3-yl]-2-[4-(dimethylamino)phenyl]acetamide.
| Compound Name | N-[(3S,4R)-4-[6-(1,1-difluoroethyl)-3-pyridinyl]pyrrolidin-3-yl]-2-[4-(dimethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 146643591 |
| Molecular Formula | C21H26F2N4O |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | N-[(3S,4R)-4-[6-(1,1-difluoroethyl)-3-pyridinyl]pyrrolidin-3-yl]-2-[4-(dimethylamino)phenyl]acetamide |
| SMILES | CN(C)c1ccc(CC(=O)N[C@@H]2CNC[C@H]2c2ccc(C(C)(F)F)nc2)cc1 |
| InChI | InChI=1S/C21H26F2N4O/c1-21(22,23)19-9-6-15(11-25-19)17-12-24-13-18(17)26-20(28)10-14-4-7-16(8-5-14)27(2)3/h4-9,11,17-18,24H,10,12-13H2,1-3H3,(H,26,28)/t17-,18+/m0/s1 |
| InChIKey | VXQJTHZMLYGLSR-ZWKOTPCHSA-N |
| XLogP | 2.67 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|