About 2-tert-butyl-6-(trifluoromethyl)oxane-3,4,5-triol
2-tert-butyl-6-(trifluoromethyl)oxane-3,4,5-triol (PubChem CID 146643726) has the molecular formula C10H17F3O4
and a molecular weight of 258.24 g/mol. Its IUPAC name is 2-tert-butyl-6-(trifluoromethyl)oxane-3,4,5-triol.
Molecular Properties
| Compound Name | 2-tert-butyl-6-(trifluoromethyl)oxane-3,4,5-triol |
| PubChem CID | 146643726 |
| Molecular Formula | C10H17F3O4 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 2-tert-butyl-6-(trifluoromethyl)oxane-3,4,5-triol |
| SMILES | CC(C)(C)C1OC(C(F)(F)F)C(O)C(O)C1O |
| InChI | InChI=1S/C10H17F3O4/c1-9(2,3)7-5(15)4(14)6(16)8(17-7)10(11,12)13/h4-8,14-16H,1-3H3 |
| InChIKey | WIGUJXIKYIVHAU-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-tert-butyl-6-(trifluoromethyl)oxane-3,4,5-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-6-(trifluoromethyl)oxane-3,4,5-triol?
The IUPAC name of 2-tert-butyl-6-(trifluoromethyl)oxane-3,4,5-triol (CID 146643726) is 2-tert-butyl-6-(trifluoromethyl)oxane-3,4,5-triol.
What is the SMILES notation for 2-tert-butyl-6-(trifluoromethyl)oxane-3,4,5-triol?
The canonical SMILES for 2-tert-butyl-6-(trifluoromethyl)oxane-3,4,5-triol is CC(C)(C)C1OC(C(F)(F)F)C(O)C(O)C1O.
What is the InChIKey of 2-tert-butyl-6-(trifluoromethyl)oxane-3,4,5-triol?
The InChIKey is WIGUJXIKYIVHAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F3O4/c1-9(2,3)7-5(15)4(14)6(16)8(17-7)10(11,12)13/h4-8,14-16H,1-3H3.
What are the key properties of 2-tert-butyl-6-(trifluoromethyl)oxane-3,4,5-triol?
2-tert-butyl-6-(trifluoromethyl)oxane-3,4,5-triol has a molecular weight of 258.24 g/mol, XLogP of 0.44, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-6-(trifluoromethyl)oxane-3,4,5-triol is sourced from PubChem (CID 146643726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).