C30H39FN4O — CID 146643736
N-[3-(7-cycloheptyl-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyridin-2-yl)phenyl]-4-fluoro-7-methyl-2,3-dihydro-1H-indole-2-carboxamide (PubChem CID 146643736) has the molecular formula C30H39FN4O and a molecular weight of 490.67 g/mol. Its IUPAC name is N-[3-(7-cycloheptyl-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyridin-2-yl)phenyl]-4-fluoro-7-methyl-2,3-dihydro-1H-indole-2-carboxamide.
| Compound Name | N-[3-(7-cycloheptyl-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyridin-2-yl)phenyl]-4-fluoro-7-methyl-2,3-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 146643736 |
| Molecular Formula | C30H39FN4O |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | N-[3-(7-cycloheptyl-1,2,3,3a,4,5,6,7-octahydropyrazolo[1,5-a]pyridin-2-yl)phenyl]-4-fluoro-7-methyl-2,3-dihydro-1H-indole-2-carboxamide |
| SMILES | Cc1ccc(F)c2c1NC(C(=O)Nc1cccc(C3CC4CCCC(C5CCCCCC5)N4N3)c1)C2 |
| InChI | InChI=1S/C30H39FN4O/c1-19-14-15-25(31)24-18-27(33-29(19)24)30(36)32-22-11-6-10-21(16-22)26-17-23-12-7-13-28(35(23)34-26)20-8-4-2-3-5-9-20/h6,10-11,14-16,20,23,26-28,33-34H,2-5,7-9,12-13,17-18H2,1H3,(H,32,36) |
| InChIKey | BLZRZPDYYLDKGL-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |