About N-[(5-ethoxy-3-methyl-1,2-dihydrobenzimidazol-4-yl)methyl]-4-(trifluoromethyl)benzamide
N-[(5-ethoxy-3-methyl-1,2-dihydrobenzimidazol-4-yl)methyl]-4-(trifluoromethyl)benzamide (PubChem CID 146643943) has the molecular formula C19H20F3N3O2
and a molecular weight of 379.38 g/mol. Its IUPAC name is N-[(5-ethoxy-3-methyl-1,2-dihydrobenzimidazol-4-yl)methyl]-4-(trifluoromethyl)benzamide.
Molecular Properties
| Compound Name | N-[(5-ethoxy-3-methyl-1,2-dihydrobenzimidazol-4-yl)methyl]-4-(trifluoromethyl)benzamide |
| PubChem CID | 146643943 |
| Molecular Formula | C19H20F3N3O2 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | N-[(5-ethoxy-3-methyl-1,2-dihydrobenzimidazol-4-yl)methyl]-4-(trifluoromethyl)benzamide |
| SMILES | CCOc1ccc2c(c1CNC(=O)c1ccc(C(F)(F)F)cc1)N(C)CN2 |
| InChI | InChI=1S/C19H20F3N3O2/c1-3-27-16-9-8-15-17(25(2)11-24-15)14(16)10-23-18(26)12-4-6-13(7-5-12)19(20,21)22/h4-9,24H,3,10-11H2,1-2H3,(H,23,26) |
| InChIKey | HJUDPFFYQKROAJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze N-[(5-ethoxy-3-methyl-1,2-dihydrobenzimidazol-4-yl)methyl]-4-(trifluoromethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-ethoxy-3-methyl-1,2-dihydrobenzimidazol-4-yl)methyl]-4-(trifluoromethyl)benzamide?
The IUPAC name of N-[(5-ethoxy-3-methyl-1,2-dihydrobenzimidazol-4-yl)methyl]-4-(trifluoromethyl)benzamide (CID 146643943) is N-[(5-ethoxy-3-methyl-1,2-dihydrobenzimidazol-4-yl)methyl]-4-(trifluoromethyl)benzamide.
What is the SMILES notation for N-[(5-ethoxy-3-methyl-1,2-dihydrobenzimidazol-4-yl)methyl]-4-(trifluoromethyl)benzamide?
The canonical SMILES for N-[(5-ethoxy-3-methyl-1,2-dihydrobenzimidazol-4-yl)methyl]-4-(trifluoromethyl)benzamide is CCOc1ccc2c(c1CNC(=O)c1ccc(C(F)(F)F)cc1)N(C)CN2.
What is the InChIKey of N-[(5-ethoxy-3-methyl-1,2-dihydrobenzimidazol-4-yl)methyl]-4-(trifluoromethyl)benzamide?
The InChIKey is HJUDPFFYQKROAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20F3N3O2/c1-3-27-16-9-8-15-17(25(2)11-24-15)14(16)10-23-18(26)12-4-6-13(7-5-12)19(20,21)22/h4-9,24H,3,10-11H2,1-2H3,(H,23,26).
What are the key properties of N-[(5-ethoxy-3-methyl-1,2-dihydrobenzimidazol-4-yl)methyl]-4-(trifluoromethyl)benzamide?
N-[(5-ethoxy-3-methyl-1,2-dihydrobenzimidazol-4-yl)methyl]-4-(trifluoromethyl)benzamide has a molecular weight of 379.38 g/mol, XLogP of 3.85, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-ethoxy-3-methyl-1,2-dihydrobenzimidazol-4-yl)methyl]-4-(trifluoromethyl)benzamide is sourced from PubChem (CID 146643943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).