C27H23F — CID 146644007
1-[(1Z,4Z)-4-ethenyl-2-(4-fluorophenyl)hepta-1,4,6-trienyl]-4-phenylbenzene (PubChem CID 146644007) has the molecular formula C27H23F and a molecular weight of 366.48 g/mol. Its IUPAC name is 1-[(1Z,4Z)-4-ethenyl-2-(4-fluorophenyl)hepta-1,4,6-trienyl]-4-phenylbenzene.
| Compound Name | 1-[(1Z,4Z)-4-ethenyl-2-(4-fluorophenyl)hepta-1,4,6-trienyl]-4-phenylbenzene |
|---|---|
| PubChem CID | 146644007 |
| Molecular Formula | C27H23F |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 1-[(1Z,4Z)-4-ethenyl-2-(4-fluorophenyl)hepta-1,4,6-trienyl]-4-phenylbenzene |
| SMILES | C=C/C=C(\C=C)C/C(=C/c1ccc(-c2ccccc2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C27H23F/c1-3-8-21(4-2)19-26(25-15-17-27(28)18-16-25)20-22-11-13-24(14-12-22)23-9-6-5-7-10-23/h3-18,20H,1-2,19H2/b21-8+,26-20- |
| InChIKey | AIVCEQXGTIMING-SSAFROFTSA-N |
| XLogP | 7.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|