C9H15FN2 — CID 146644462
(Z)-N'-[(2E)-4-fluoropenta-2,4-dien-2-yl]-N,N'-dimethylethene-1,2-diamine (PubChem CID 146644462) has the molecular formula C9H15FN2 and a molecular weight of 170.23 g/mol. Its IUPAC name is (Z)-N'-[(2E)-4-fluoropenta-2,4-dien-2-yl]-N,N'-dimethylethene-1,2-diamine.
| Compound Name | (Z)-N'-[(2E)-4-fluoropenta-2,4-dien-2-yl]-N,N'-dimethylethene-1,2-diamine |
|---|---|
| PubChem CID | 146644462 |
| Molecular Formula | C9H15FN2 |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | (Z)-N'-[(2E)-4-fluoropenta-2,4-dien-2-yl]-N,N'-dimethylethene-1,2-diamine |
| SMILES | C=C(F)/C=C(\C)N(C)/C=C\NC |
| InChI | InChI=1S/C9H15FN2/c1-8(10)7-9(2)12(4)6-5-11-3/h5-7,11H,1H2,2-4H3/b6-5-,9-7+ |
| InChIKey | MBFMTFUXWIRLBC-BZWSEGBZSA-N |
| XLogP | 2.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|