C24H32FN5O — CID 146644490
4-fluoro-7-methyl-N-[3-[1-[2-(propylamino)ethyl]pyrazolidin-4-yl]phenyl]-2,3-dihydro-1H-indole-2-carboxamide (PubChem CID 146644490) has the molecular formula C24H32FN5O and a molecular weight of 425.55 g/mol. Its IUPAC name is 4-fluoro-7-methyl-N-[3-[1-[2-(propylamino)ethyl]pyrazolidin-4-yl]phenyl]-2,3-dihydro-1H-indole-2-carboxamide.
| Compound Name | 4-fluoro-7-methyl-N-[3-[1-[2-(propylamino)ethyl]pyrazolidin-4-yl]phenyl]-2,3-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 146644490 |
| Molecular Formula | C24H32FN5O |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | 4-fluoro-7-methyl-N-[3-[1-[2-(propylamino)ethyl]pyrazolidin-4-yl]phenyl]-2,3-dihydro-1H-indole-2-carboxamide |
| SMILES | CCCNCCN1CC(c2cccc(NC(=O)C3Cc4c(F)ccc(C)c4N3)c2)CN1 |
| InChI | InChI=1S/C24H32FN5O/c1-3-9-26-10-11-30-15-18(14-27-30)17-5-4-6-19(12-17)28-24(31)22-13-20-21(25)8-7-16(2)23(20)29-22/h4-8,12,18,22,26-27,29H,3,9-11,13-15H2,1-2H3,(H,28,31) |
| InChIKey | CECALLSCJWQYON-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 68.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|