C11H15NO — CID 146644632
1-[(1R,5S,6R)-3,6-dimethyl-2-bicyclo[3.1.0]hex-2-enyl]-1-iminopropan-2-one (PubChem CID 146644632) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 1-[(1R,5S,6R)-3,6-dimethyl-2-bicyclo[3.1.0]hex-2-enyl]-1-iminopropan-2-one.
| Compound Name | 1-[(1R,5S,6R)-3,6-dimethyl-2-bicyclo[3.1.0]hex-2-enyl]-1-iminopropan-2-one |
|---|---|
| PubChem CID | 146644632 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 1-[(1R,5S,6R)-3,6-dimethyl-2-bicyclo[3.1.0]hex-2-enyl]-1-iminopropan-2-one |
| SMILES | [H]/N=C(\C(C)=O)C1=C(C)C[C@H]2[C@@H](C)[C@@H]12 |
| InChI | InChI=1S/C11H15NO/c1-5-4-8-6(2)10(8)9(5)11(12)7(3)13/h6,8,10,12H,4H2,1-3H3/b12-11+/t6-,8+,10-/m1/s1 |
| InChIKey | TYNJAZPGNFAQRM-ZJVSGMGHSA-N |
| XLogP | 2.20 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|