C21H42N2O — CID 146644692
(6Z)-N-[[(2R)-2-[ethyl(propyl)amino]butoxy]methyl]-4,8-dimethylnona-6,8-dien-3-amine (PubChem CID 146644692) has the molecular formula C21H42N2O and a molecular weight of 338.58 g/mol. Its IUPAC name is (6Z)-N-[[(2R)-2-[ethyl(propyl)amino]butoxy]methyl]-4,8-dimethylnona-6,8-dien-3-amine.
| Compound Name | (6Z)-N-[[(2R)-2-[ethyl(propyl)amino]butoxy]methyl]-4,8-dimethylnona-6,8-dien-3-amine |
|---|---|
| PubChem CID | 146644692 |
| Molecular Formula | C21H42N2O |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.33 |
| IUPAC Name | (6Z)-N-[[(2R)-2-[ethyl(propyl)amino]butoxy]methyl]-4,8-dimethylnona-6,8-dien-3-amine |
| SMILES | C=C(C)/C=C\CC(C)C(CC)NCOC[C@@H](CC)N(CC)CCC |
| InChI | InChI=1S/C21H42N2O/c1-8-15-23(11-4)20(9-2)16-24-17-22-21(10-3)19(7)14-12-13-18(5)6/h12-13,19-22H,5,8-11,14-17H2,1-4,6-7H3/b13-12-/t19?,20-,21?/m1/s1 |
| InChIKey | CBVUSIRWTXSLTI-NYGPEUIISA-N |
| XLogP | 5.00 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|