C50H40N6O4S2 — CID 146644714
[4-[(3Z,6Z)-3,6-bis[1,3-benzothiazol-2-yl(cyano)methylidene]-4-[4-(cyclohexanecarbonyloxy)phenyl]-2,5-dihydropyrrolo[3,4-c]pyrrol-1-yl]phenyl] cyclohexanecarboxylate (PubChem CID 146644714) has the molecular formula C50H40N6O4S2 and a molecular weight of 853.04 g/mol. Its IUPAC name is [4-[(3Z,6Z)-3,6-bis[1,3-benzothiazol-2-yl(cyano)methylidene]-4-[4-(cyclohexanecarbonyloxy)phenyl]-2,5-dihydropyrrolo[3,4-c]pyrrol-1-yl]phenyl] cyclohexanecarboxylate.
| Compound Name | [4-[(3Z,6Z)-3,6-bis[1,3-benzothiazol-2-yl(cyano)methylidene]-4-[4-(cyclohexanecarbonyloxy)phenyl]-2,5-dihydropyrrolo[3,4-c]pyrrol-1-yl]phenyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 146644714 |
| Molecular Formula | C50H40N6O4S2 |
| Molecular Weight | 853.04 g/mol |
| Exact Mass | 852.26 |
| IUPAC Name | [4-[(3Z,6Z)-3,6-bis[1,3-benzothiazol-2-yl(cyano)methylidene]-4-[4-(cyclohexanecarbonyloxy)phenyl]-2,5-dihydropyrrolo[3,4-c]pyrrol-1-yl]phenyl] cyclohexanecarboxylate |
| SMILES | N#C/C(c1nc2ccccc2s1)=c1/[nH]c(-c2ccc(OC(=O)C3CCCCC3)cc2)c2/c(=C(\C#N)c3nc4ccccc4s3)[nH]c(-c3ccc(OC(=O)C4CCCCC4)cc3)c12 |
| InChI | InChI=1S/C50H40N6O4S2/c51-27-35(47-53-37-15-7-9-17-39(37)61-47)45-41-42(44(56-45)30-21-25-34(26-22-30)60-50(58)32-13-5-2-6-14-32)46(36(28-52)48-54-38-16-8-10-18-40(38)62-48)55-43(41)29-19-23-33(24-20-29)59-49(57)31-11-3-1-4-12-31/h7-10,15-26,31-32,55-56H,1-6,11-14H2/b45-35-,46-36- |
| InChIKey | MBFZAQURVKWKDR-RYMWFAGJSA-N |
| XLogP | 10.47 |
| TPSA | 157.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.04 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|