About [3-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-1H-pyrazol-5-yl]methanol
[3-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-1H-pyrazol-5-yl]methanol (PubChem CID 146645024) has the molecular formula C10H8ClN5OS
and a molecular weight of 281.73 g/mol. Its IUPAC name is [3-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-1H-pyrazol-5-yl]methanol.
Molecular Properties
| Compound Name | [3-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-1H-pyrazol-5-yl]methanol |
| PubChem CID | 146645024 |
| Molecular Formula | C10H8ClN5OS |
| Molecular Weight | 281.73 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | [3-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-1H-pyrazol-5-yl]methanol |
| SMILES | OCc1cc(Nc2nc(Cl)nc3sccc23)n[nH]1 |
| InChI | InChI=1S/C10H8ClN5OS/c11-10-13-8(6-1-2-18-9(6)14-10)12-7-3-5(4-17)15-16-7/h1-3,17H,4H2,(H2,12,13,14,15,16) |
| InChIKey | IAXJOQMIXGEUDM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.73 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-1H-pyrazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-1H-pyrazol-5-yl]methanol?
The IUPAC name of [3-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-1H-pyrazol-5-yl]methanol (CID 146645024) is [3-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-1H-pyrazol-5-yl]methanol.
What is the SMILES notation for [3-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-1H-pyrazol-5-yl]methanol?
The canonical SMILES for [3-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-1H-pyrazol-5-yl]methanol is OCc1cc(Nc2nc(Cl)nc3sccc23)n[nH]1.
What is the InChIKey of [3-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-1H-pyrazol-5-yl]methanol?
The InChIKey is IAXJOQMIXGEUDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClN5OS/c11-10-13-8(6-1-2-18-9(6)14-10)12-7-3-5(4-17)15-16-7/h1-3,17H,4H2,(H2,12,13,14,15,16).
What are the key properties of [3-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-1H-pyrazol-5-yl]methanol?
[3-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-1H-pyrazol-5-yl]methanol has a molecular weight of 281.73 g/mol, XLogP of 2.30, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]-1H-pyrazol-5-yl]methanol is sourced from PubChem (CID 146645024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).