C19H24ClN5 — CID 146645217
3-[4-[(7-chloro-1,6-naphthyridin-5-yl)amino]-2-ethyl-6-methylpiperidin-1-yl]propanenitrile (PubChem CID 146645217) has the molecular formula C19H24ClN5 and a molecular weight of 357.89 g/mol. Its IUPAC name is 3-[4-[(7-chloro-1,6-naphthyridin-5-yl)amino]-2-ethyl-6-methylpiperidin-1-yl]propanenitrile.
| Compound Name | 3-[4-[(7-chloro-1,6-naphthyridin-5-yl)amino]-2-ethyl-6-methylpiperidin-1-yl]propanenitrile |
|---|---|
| PubChem CID | 146645217 |
| Molecular Formula | C19H24ClN5 |
| Molecular Weight | 357.89 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 3-[4-[(7-chloro-1,6-naphthyridin-5-yl)amino]-2-ethyl-6-methylpiperidin-1-yl]propanenitrile |
| SMILES | CCC1CC(Nc2nc(Cl)cc3ncccc23)CC(C)N1CCC#N |
| InChI | InChI=1S/C19H24ClN5/c1-3-15-11-14(10-13(2)25(15)9-5-7-21)23-19-16-6-4-8-22-17(16)12-18(20)24-19/h4,6,8,12-15H,3,5,9-11H2,1-2H3,(H,23,24) |
| InChIKey | JCWKCZGZNFCFOB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.89 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|